C24H38N4O5 — CID 123257241
2-[[2-benzyl-3-[formyl(hydroxy)amino]butanoyl]amino]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 123257241) has the molecular formula C24H38N4O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is 2-[[2-benzyl-3-[formyl(hydroxy)amino]butanoyl]amino]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide.
| Compound Name | 2-[[2-benzyl-3-[formyl(hydroxy)amino]butanoyl]amino]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 123257241 |
| Molecular Formula | C24H38N4O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 2-[[2-benzyl-3-[formyl(hydroxy)amino]butanoyl]amino]-3,3-dimethyl-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | CC(C(Cc1ccccc1)C(=O)NC(C(=O)NCCN1CCOCC1)C(C)(C)C)N(O)C=O |
| InChI | InChI=1S/C24H38N4O5/c1-18(28(32)17-29)20(16-19-8-6-5-7-9-19)22(30)26-21(24(2,3)4)23(31)25-10-11-27-12-14-33-15-13-27/h5-9,17-18,20-21,32H,10-16H2,1-4H3,(H,25,31)(H,26,30) |
| InChIKey | GPZKPBPYQCDGTC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|