C26H42N4O5 — CID 85472541
(2S)-N-[(2S)-3,3-dimethyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]-2-[(1R)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide (PubChem CID 85472541) has the molecular formula C26H42N4O5 and a molecular weight of 490.65 g/mol. Its IUPAC name is (2S)-N-[(2S)-3,3-dimethyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]-2-[(1R)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide.
| Compound Name | (2S)-N-[(2S)-3,3-dimethyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]-2-[(1R)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 85472541 |
| Molecular Formula | C26H42N4O5 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | (2S)-N-[(2S)-3,3-dimethyl-1-(2-morpholin-4-ylethylamino)-1-oxobutan-2-yl]-2-[(1R)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide |
| SMILES | C[C@H](C(CCCc1ccccc1)C(=O)N[C@H](C(=O)NCCN1CCOCC1)C(C)(C)C)N(O)C=O |
| InChI | InChI=1S/C26H42N4O5/c1-20(30(34)19-31)22(12-8-11-21-9-6-5-7-10-21)24(32)28-23(26(2,3)4)25(33)27-13-14-29-15-17-35-18-16-29/h5-7,9-10,19-20,22-23,34H,8,11-18H2,1-4H3,(H,27,33)(H,28,32)/t20-,22?,23-/m1/s1 |
| InChIKey | IIIQVNBDRVHABI-WPLVIQRKSA-N |
| XLogP | 1.84 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|