C25H36N4O4S — CID 91185443
(2R,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanamide (PubChem CID 91185443) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanamide.
| Compound Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanamide |
|---|---|
| PubChem CID | 91185443 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanamide |
| SMILES | CCC[C@@H]([C@@H](CCCc1ccccc1)C(=O)N[C@H](C(=O)Nc1nccs1)C(C)(C)C)N(O)C=O |
| InChI | InChI=1S/C25H36N4O4S/c1-5-10-20(29(33)17-30)19(14-9-13-18-11-7-6-8-12-18)22(31)27-21(25(2,3)4)23(32)28-24-26-15-16-34-24/h6-8,11-12,15-17,19-21,33H,5,9-10,13-14H2,1-4H3,(H,27,31)(H,26,28,32)/t19-,20+,21-/m1/s1 |
| InChIKey | KNRMIFOJNPFLLV-QHAWAJNXSA-N |
| XLogP | 4.27 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|