C20H33N7O6S — CID 136659919
3-[formyl(hydroxy)amino]-N-[6-imino-6-nitramido-1-oxo-1-(1,3-thiazol-2-ylamino)hexan-2-yl]-2-(2-methylpropyl)hexanamide (PubChem CID 136659919) has the molecular formula C20H33N7O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is 3-[formyl(hydroxy)amino]-N-[6-imino-6-nitramido-1-oxo-1-(1,3-thiazol-2-ylamino)hexan-2-yl]-2-(2-methylpropyl)hexanamide.
| Compound Name | 3-[formyl(hydroxy)amino]-N-[6-imino-6-nitramido-1-oxo-1-(1,3-thiazol-2-ylamino)hexan-2-yl]-2-(2-methylpropyl)hexanamide |
|---|---|
| PubChem CID | 136659919 |
| Molecular Formula | C20H33N7O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 3-[formyl(hydroxy)amino]-N-[6-imino-6-nitramido-1-oxo-1-(1,3-thiazol-2-ylamino)hexan-2-yl]-2-(2-methylpropyl)hexanamide |
| SMILES | [H]/N=C(/CCCC(NC(=O)C(CC(C)C)C(CCC)N(O)C=O)C(=O)Nc1nccs1)N[N+](=O)[O-] |
| InChI | InChI=1S/C20H33N7O6S/c1-4-6-16(26(31)12-28)14(11-13(2)3)18(29)23-15(7-5-8-17(21)25-27(32)33)19(30)24-20-22-9-10-34-20/h9-10,12-16,31H,4-8,11H2,1-3H3,(H2,21,25)(H,23,29)(H,22,24,30) |
| InChIKey | WVHJVZJGGQTVBO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|