C20H34N8O6S — CID 90830053
(2R,3S)-3-[formyl(hydroxy)amino]-N-[(2S)-5-[methyl-(nitrodiazenyl)amino]-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)hexanamide (PubChem CID 90830053) has the molecular formula C20H34N8O6S and a molecular weight of 514.61 g/mol. Its IUPAC name is (2R,3S)-3-[formyl(hydroxy)amino]-N-[(2S)-5-[methyl-(nitrodiazenyl)amino]-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)hexanamide.
| Compound Name | (2R,3S)-3-[formyl(hydroxy)amino]-N-[(2S)-5-[methyl-(nitrodiazenyl)amino]-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)hexanamide |
|---|---|
| PubChem CID | 90830053 |
| Molecular Formula | C20H34N8O6S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | (2R,3S)-3-[formyl(hydroxy)amino]-N-[(2S)-5-[methyl-(nitrodiazenyl)amino]-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)hexanamide |
| SMILES | CCC[C@@H]([C@@H](CC(C)C)C(=O)N[C@@H](CCCN(C)N=N[N+](=O)[O-])C(=O)Nc1nccs1)N(O)C=O |
| InChI | InChI=1S/C20H34N8O6S/c1-5-7-17(27(32)13-29)15(12-14(2)3)18(30)22-16(19(31)23-20-21-9-11-35-20)8-6-10-26(4)24-25-28(33)34/h9,11,13-17,32H,5-8,10,12H2,1-4H3,(H,22,30)(H,21,23,31)/t15-,16+,17+/m1/s1 |
| InChIKey | IZKRQCJEDIGGEV-IKGGRYGDSA-N |
| XLogP | 2.52 |
| TPSA | 182.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|