C9H13N7O4S — CID 173281092
5-[carbamoyl-(nitrodiazenyl)amino]-N-(1,3-thiazol-2-yl)pentanamide (PubChem CID 173281092) has the molecular formula C9H13N7O4S and a molecular weight of 315.31 g/mol. Its IUPAC name is 5-[carbamoyl-(nitrodiazenyl)amino]-N-(1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-[carbamoyl-(nitrodiazenyl)amino]-N-(1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 173281092 |
| Molecular Formula | C9H13N7O4S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-[carbamoyl-(nitrodiazenyl)amino]-N-(1,3-thiazol-2-yl)pentanamide |
| SMILES | NC(=O)N(CCCCC(=O)Nc1nccs1)N=N[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N7O4S/c10-8(18)15(13-14-16(19)20)5-2-1-3-7(17)12-9-11-4-6-21-9/h4,6H,1-3,5H2,(H2,10,18)(H,11,12,17) |
| InChIKey | HIFSHHHEIIVOHR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 156.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|