C20H32N4O4S — CID 135582726
(2S,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-prop-2-enylbutanediamide (PubChem CID 135582726) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is (2S,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-prop-2-enylbutanediamide.
| Compound Name | (2S,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 135582726 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (2S,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-prop-2-enylbutanediamide |
| SMILES | C=CC[C@H](C(=O)NO)[C@H](CC(C)C)C(=O)N[C@H](C(=O)Nc1nccs1)C(C)(C)C |
| InChI | InChI=1S/C20H32N4O4S/c1-7-8-13(17(26)24-28)14(11-12(2)3)16(25)22-15(20(4,5)6)18(27)23-19-21-9-10-29-19/h7,9-10,12-15,28H,1,8,11H2,2-6H3,(H,22,25)(H,24,26)(H,21,23,27)/t13-,14-,15+/m0/s1 |
| InChIKey | DJYWVAOUWMVLTL-SOUVJXGZSA-N |
| XLogP | 2.97 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|