C23H38N8O6S — CID 135529029
(2S,3R)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2R)-5-[[(Z)-N'-nitrocarbamimidoyl]amino]-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]hexanamide (PubChem CID 135529029) has the molecular formula C23H38N8O6S and a molecular weight of 554.67 g/mol. Its IUPAC name is (2S,3R)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2R)-5-[[(Z)-N'-nitrocarbamimidoyl]amino]-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]hexanamide.
| Compound Name | (2S,3R)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2R)-5-[[(Z)-N'-nitrocarbamimidoyl]amino]-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 135529029 |
| Molecular Formula | C23H38N8O6S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | (2S,3R)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2R)-5-[[(Z)-N'-nitrocarbamimidoyl]amino]-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]hexanamide |
| SMILES | CCC[C@H]([C@H](CC1CCCCC1)C(=O)N[C@H](CCCN/C(N)=N\[N+](=O)[O-])C(=O)Nc1nccs1)N(O)C=O |
| InChI | InChI=1S/C23H38N8O6S/c1-2-7-19(30(35)15-32)17(14-16-8-4-3-5-9-16)20(33)27-18(21(34)28-23-26-12-13-38-23)10-6-11-25-22(24)29-31(36)37/h12-13,15-19,35H,2-11,14H2,1H3,(H,27,33)(H3,24,25,29)(H,26,28,34)/t17-,18+,19+/m0/s1 |
| InChIKey | FWJFNXPZKLJJSG-IPMKNSEASA-N |
| XLogP | 2.05 |
| TPSA | 205.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|