C25H40N4O4 — CID 44532107
(2R,3S)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S,3R)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]hexanamide (PubChem CID 44532107) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is (2R,3S)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S,3R)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]hexanamide.
| Compound Name | (2R,3S)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S,3R)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 44532107 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (2R,3S)-2-(cyclohexylmethyl)-3-[formyl(hydroxy)amino]-N-[(2S,3R)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]hexanamide |
| SMILES | CCC[C@@H]([C@@H](CC1CCCCC1)C(=O)N[C@H](C(=O)Nc1ccccn1)[C@H](C)CC)N(O)C=O |
| InChI | InChI=1S/C25H40N4O4/c1-4-11-21(29(33)17-30)20(16-19-12-7-6-8-13-19)24(31)28-23(18(3)5-2)25(32)27-22-14-9-10-15-26-22/h9-10,14-15,17-21,23,33H,4-8,11-13,16H2,1-3H3,(H,28,31)(H,26,27,32)/t18-,20-,21+,23+/m1/s1 |
| InChIKey | WMZZMPLMDHHRPU-WQJYWUQFSA-N |
| XLogP | 4.15 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|