C22H36N4O4 — CID 89051069
(3S)-3-[formyl(hydroxy)amino]-4-methyl-N-[(2S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)pentanamide (PubChem CID 89051069) has the molecular formula C22H36N4O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is (3S)-3-[formyl(hydroxy)amino]-4-methyl-N-[(2S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)pentanamide.
| Compound Name | (3S)-3-[formyl(hydroxy)amino]-4-methyl-N-[(2S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 89051069 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | (3S)-3-[formyl(hydroxy)amino]-4-methyl-N-[(2S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(2-methylpropyl)pentanamide |
| SMILES | CCC(C)[C@H](NC(=O)C(CC(C)C)[C@H](C(C)C)N(O)C=O)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C22H36N4O4/c1-7-16(6)19(22(29)24-18-10-8-9-11-23-18)25-21(28)17(12-14(2)3)20(15(4)5)26(30)13-27/h8-11,13-17,19-20,30H,7,12H2,1-6H3,(H,25,28)(H,23,24,29)/t16?,17?,19-,20-/m0/s1 |
| InChIKey | SMZPWUUYPYYHIV-WXDAQCLHSA-N |
| XLogP | 3.09 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|