C22H36N4O4 — CID 10342101
N-hydroxy-N'-[3-methyl-5-oxo-5-(pyridin-2-ylamino)pentyl]-3-(2-methylpropyl)-2-propan-2-ylbutanediamide (PubChem CID 10342101) has the molecular formula C22H36N4O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-hydroxy-N'-[3-methyl-5-oxo-5-(pyridin-2-ylamino)pentyl]-3-(2-methylpropyl)-2-propan-2-ylbutanediamide.
| Compound Name | N-hydroxy-N'-[3-methyl-5-oxo-5-(pyridin-2-ylamino)pentyl]-3-(2-methylpropyl)-2-propan-2-ylbutanediamide |
|---|---|
| PubChem CID | 10342101 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | N-hydroxy-N'-[3-methyl-5-oxo-5-(pyridin-2-ylamino)pentyl]-3-(2-methylpropyl)-2-propan-2-ylbutanediamide |
| SMILES | CC(C)CC(C(=O)NCCC(C)CC(=O)Nc1ccccn1)C(C(=O)NO)C(C)C |
| InChI | InChI=1S/C22H36N4O4/c1-14(2)12-17(20(15(3)4)22(29)26-30)21(28)24-11-9-16(5)13-19(27)25-18-8-6-7-10-23-18/h6-8,10,14-17,20,30H,9,11-13H2,1-5H3,(H,24,28)(H,26,29)(H,23,25,27) |
| InChIKey | QSJOESDHKFYUTJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|