C30H44N4O4 — CID 91311380
(2R,3S)-3-[formyl(hydroxy)amino]-7-methyl-N-[(2S,3S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(3-phenylpropyl)octanamide (PubChem CID 91311380) has the molecular formula C30H44N4O4 and a molecular weight of 524.71 g/mol. Its IUPAC name is (2R,3S)-3-[formyl(hydroxy)amino]-7-methyl-N-[(2S,3S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(3-phenylpropyl)octanamide.
| Compound Name | (2R,3S)-3-[formyl(hydroxy)amino]-7-methyl-N-[(2S,3S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(3-phenylpropyl)octanamide |
|---|---|
| PubChem CID | 91311380 |
| Molecular Formula | C30H44N4O4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | (2R,3S)-3-[formyl(hydroxy)amino]-7-methyl-N-[(2S,3S)-3-methyl-1-oxo-1-(pyridin-2-ylamino)pentan-2-yl]-2-(3-phenylpropyl)octanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCc1ccccc1)[C@H](CCCC(C)C)N(O)C=O)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C30H44N4O4/c1-5-23(4)28(30(37)32-27-19-9-10-20-31-27)33-29(36)25(17-12-16-24-14-7-6-8-15-24)26(34(38)21-35)18-11-13-22(2)3/h6-10,14-15,19-23,25-26,28,38H,5,11-13,16-18H2,1-4H3,(H,33,36)(H,31,32,37)/t23-,25+,26-,28-/m0/s1 |
| InChIKey | FBIYFXRIWHOHPL-IWEUKVTLSA-N |
| XLogP | 5.23 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|