C16H20F3NO4 — CID 21256875
6,6,6-trifluoro-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanoic acid (PubChem CID 21256875) has the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 6,6,6-trifluoro-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanoic acid.
| Compound Name | 6,6,6-trifluoro-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanoic acid |
|---|---|
| PubChem CID | 21256875 |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 6,6,6-trifluoro-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanoic acid |
| SMILES | O=CN(O)C(CCC(F)(F)F)C(CCCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H20F3NO4/c17-16(18,19)10-9-14(20(24)11-21)13(15(22)23)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,11,13-14,24H,4,7-10H2,(H,22,23) |
| InChIKey | SIJGQYZTVBUQLS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|