C24H24O4 — CID 126455555
(2R)-5-phenyl-2-(2-phenylmethoxyphenoxy)pentanoic acid (PubChem CID 126455555) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is (2R)-5-phenyl-2-(2-phenylmethoxyphenoxy)pentanoic acid.
| Compound Name | (2R)-5-phenyl-2-(2-phenylmethoxyphenoxy)pentanoic acid |
|---|---|
| PubChem CID | 126455555 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2R)-5-phenyl-2-(2-phenylmethoxyphenoxy)pentanoic acid |
| SMILES | O=C(O)[C@@H](CCCc1ccccc1)Oc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H24O4/c25-24(26)23(17-9-14-19-10-3-1-4-11-19)28-22-16-8-7-15-21(22)27-18-20-12-5-2-6-13-20/h1-8,10-13,15-16,23H,9,14,17-18H2,(H,25,26)/t23-/m1/s1 |
| InChIKey | QCCNGXAHIGEJIA-HSZRJFAPSA-N |
| XLogP | 5.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |