C26H34O8 — CID 15369029
2-[2-[2-[2-(1-carboxypentoxy)phenoxy]ethoxy]phenoxy]hexanoic acid (PubChem CID 15369029) has the molecular formula C26H34O8 and a molecular weight of 474.55 g/mol. Its IUPAC name is 2-[2-[2-[2-(1-carboxypentoxy)phenoxy]ethoxy]phenoxy]hexanoic acid.
| Compound Name | 2-[2-[2-[2-(1-carboxypentoxy)phenoxy]ethoxy]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 15369029 |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[2-[2-[2-(1-carboxypentoxy)phenoxy]ethoxy]phenoxy]hexanoic acid |
| SMILES | CCCCC(Oc1ccccc1OCCOc1ccccc1OC(CCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H34O8/c1-3-5-11-23(25(27)28)33-21-15-9-7-13-19(21)31-17-18-32-20-14-8-10-16-22(20)34-24(26(29)30)12-6-4-2/h7-10,13-16,23-24H,3-6,11-12,17-18H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | SQKPPUFKJJCNQB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|