C18H19BrO4 — CID 154940943
4-bromo-2-(5-methyl-2-phenylmethoxyphenoxy)butanoic acid (PubChem CID 154940943) has the molecular formula C18H19BrO4 and a molecular weight of 379.25 g/mol. Its IUPAC name is 4-bromo-2-(5-methyl-2-phenylmethoxyphenoxy)butanoic acid.
| Compound Name | 4-bromo-2-(5-methyl-2-phenylmethoxyphenoxy)butanoic acid |
|---|---|
| PubChem CID | 154940943 |
| Molecular Formula | C18H19BrO4 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 4-bromo-2-(5-methyl-2-phenylmethoxyphenoxy)butanoic acid |
| SMILES | Cc1ccc(OCc2ccccc2)c(OC(CCBr)C(=O)O)c1 |
| InChI | InChI=1S/C18H19BrO4/c1-13-7-8-15(22-12-14-5-3-2-4-6-14)17(11-13)23-16(9-10-19)18(20)21/h2-8,11,16H,9-10,12H2,1H3,(H,20,21) |
| InChIKey | QWOBCJSFLIRGAF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|