C25H24Br2O3 — CID 12905171
1-[3,4-bis(phenylmethoxy)phenyl]-2,5-dibromopentan-1-one (PubChem CID 12905171) has the molecular formula C25H24Br2O3 and a molecular weight of 532.27 g/mol. Its IUPAC name is 1-[3,4-bis(phenylmethoxy)phenyl]-2,5-dibromopentan-1-one.
| Compound Name | 1-[3,4-bis(phenylmethoxy)phenyl]-2,5-dibromopentan-1-one |
|---|---|
| PubChem CID | 12905171 |
| Molecular Formula | C25H24Br2O3 |
| Molecular Weight | 532.27 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 1-[3,4-bis(phenylmethoxy)phenyl]-2,5-dibromopentan-1-one |
| SMILES | O=C(c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)C(Br)CCCBr |
| InChI | InChI=1S/C25H24Br2O3/c26-15-7-12-22(27)25(28)21-13-14-23(29-17-19-8-3-1-4-9-19)24(16-21)30-18-20-10-5-2-6-11-20/h1-6,8-11,13-14,16,22H,7,12,15,17-18H2 |
| InChIKey | YICSONKRKAMOPG-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.27 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|