C24H40N4O4 — CID 118876979
N-[1-[2-(dimethylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-2-[(1S)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide (PubChem CID 118876979) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-2-[(1S)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide.
| Compound Name | N-[1-[2-(dimethylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-2-[(1S)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 118876979 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-2-[(1S)-1-[formyl(hydroxy)amino]ethyl]-5-phenylpentanamide |
| SMILES | C[C@@H](C(CCCc1ccccc1)C(=O)NC(C(=O)NCCN(C)C)C(C)(C)C)N(O)C=O |
| InChI | InChI=1S/C24H40N4O4/c1-18(28(32)17-29)20(14-10-13-19-11-8-7-9-12-19)22(30)26-21(24(2,3)4)23(31)25-15-16-27(5)6/h7-9,11-12,17-18,20-21,32H,10,13-16H2,1-6H3,(H,25,31)(H,26,30)/t18-,20?,21?/m0/s1 |
| InChIKey | DGAPDZDPDMXMFJ-PELRDEGISA-N |
| XLogP | 2.07 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|