C27H43N3O5 — CID 159421813
(2S,5R)-2-tert-butyl-5-[(1S)-1-[formyl(hydroxy)amino]ethyl]-N-(2-morpholin-4-ylethyl)-4-oxo-8-phenyloctanamide (PubChem CID 159421813) has the molecular formula C27H43N3O5 and a molecular weight of 489.66 g/mol. Its IUPAC name is (2S,5R)-2-tert-butyl-5-[(1S)-1-[formyl(hydroxy)amino]ethyl]-N-(2-morpholin-4-ylethyl)-4-oxo-8-phenyloctanamide.
| Compound Name | (2S,5R)-2-tert-butyl-5-[(1S)-1-[formyl(hydroxy)amino]ethyl]-N-(2-morpholin-4-ylethyl)-4-oxo-8-phenyloctanamide |
|---|---|
| PubChem CID | 159421813 |
| Molecular Formula | C27H43N3O5 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | (2S,5R)-2-tert-butyl-5-[(1S)-1-[formyl(hydroxy)amino]ethyl]-N-(2-morpholin-4-ylethyl)-4-oxo-8-phenyloctanamide |
| SMILES | C[C@@H]([C@@H](CCCc1ccccc1)C(=O)C[C@H](C(=O)NCCN1CCOCC1)C(C)(C)C)N(O)C=O |
| InChI | InChI=1S/C27H43N3O5/c1-21(30(34)20-31)23(12-8-11-22-9-6-5-7-10-22)25(32)19-24(27(2,3)4)26(33)28-13-14-29-15-17-35-18-16-29/h5-7,9-10,20-21,23-24,34H,8,11-19H2,1-4H3,(H,28,33)/t21-,23+,24+/m0/s1 |
| InChIKey | VCUVRQLYXDYWMK-QPTUXGOLSA-N |
| XLogP | 2.93 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|