C17H26FN3O2 — CID 126595681
2-amino-5-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)pentanamide (PubChem CID 126595681) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-amino-5-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)pentanamide.
| Compound Name | 2-amino-5-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)pentanamide |
|---|---|
| PubChem CID | 126595681 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-amino-5-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)pentanamide |
| SMILES | NC(CCCc1ccc(F)cc1)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H26FN3O2/c18-15-6-4-14(5-7-15)2-1-3-16(19)17(22)20-8-9-21-10-12-23-13-11-21/h4-7,16H,1-3,8-13,19H2,(H,20,22) |
| InChIKey | APHFDHLXXJQJRZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |