C18H26FN3O3 — CID 110305497
3-(4-fluorophenyl)-2-methyl-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]propanamide (PubChem CID 110305497) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-methyl-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]propanamide.
| Compound Name | 3-(4-fluorophenyl)-2-methyl-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 110305497 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 3-(4-fluorophenyl)-2-methyl-N-[2-(2-morpholin-4-ylethylamino)-2-oxoethyl]propanamide |
| SMILES | CC(Cc1ccc(F)cc1)C(=O)NCC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H26FN3O3/c1-14(12-15-2-4-16(19)5-3-15)18(24)21-13-17(23)20-6-7-22-8-10-25-11-9-22/h2-5,14H,6-13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | LBFOQUKUQGPINP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |