C27H38N4O4 — CID 90691763
(2R,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(pyridin-3-ylamino)butan-2-yl]-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanamide (PubChem CID 90691763) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is (2R,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(pyridin-3-ylamino)butan-2-yl]-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanamide.
| Compound Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(pyridin-3-ylamino)butan-2-yl]-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanamide |
|---|---|
| PubChem CID | 90691763 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (2R,3S)-N-[(2S)-3,3-dimethyl-1-oxo-1-(pyridin-3-ylamino)butan-2-yl]-3-[formyl(hydroxy)amino]-2-(3-phenylpropyl)hexanamide |
| SMILES | CCC[C@@H]([C@@H](CCCc1ccccc1)C(=O)N[C@H](C(=O)Nc1cccnc1)C(C)(C)C)N(O)C=O |
| InChI | InChI=1S/C27H38N4O4/c1-5-11-23(31(35)19-32)22(16-9-14-20-12-7-6-8-13-20)25(33)30-24(27(2,3)4)26(34)29-21-15-10-17-28-18-21/h6-8,10,12-13,15,17-19,22-24,35H,5,9,11,14,16H2,1-4H3,(H,29,34)(H,30,33)/t22-,23+,24-/m1/s1 |
| InChIKey | CYAWKSZBVIFJEZ-TZRRMPRUSA-N |
| XLogP | 4.21 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|