C24H34N4O3 — CID 10224339
(2S)-3-cyclohexyl-2-[(4S)-4-(cyclohexylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-pyridin-2-ylpropanamide (PubChem CID 10224339) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-[(4S)-4-(cyclohexylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-pyridin-2-ylpropanamide.
| Compound Name | (2S)-3-cyclohexyl-2-[(4S)-4-(cyclohexylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 10224339 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (2S)-3-cyclohexyl-2-[(4S)-4-(cyclohexylmethyl)-2,5-dioxoimidazolidin-1-yl]-N-pyridin-2-ylpropanamide |
| SMILES | O=C(Nc1ccccn1)[C@H](CC1CCCCC1)N1C(=O)N[C@@H](CC2CCCCC2)C1=O |
| InChI | InChI=1S/C24H34N4O3/c29-22(27-21-13-7-8-14-25-21)20(16-18-11-5-2-6-12-18)28-23(30)19(26-24(28)31)15-17-9-3-1-4-10-17/h7-8,13-14,17-20H,1-6,9-12,15-16H2,(H,26,31)(H,25,27,29)/t19-,20-/m0/s1 |
| InChIKey | ONRUYMVZUXQLRF-PMACEKPBSA-N |
| XLogP | 4.25 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|