C19H23N3O3 — CID 123519236
1-(1-cyclohexyl-3-oxo-4-pyridin-2-ylbutan-2-yl)pyrimidine-2,4-dione (PubChem CID 123519236) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-(1-cyclohexyl-3-oxo-4-pyridin-2-ylbutan-2-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(1-cyclohexyl-3-oxo-4-pyridin-2-ylbutan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123519236 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-(1-cyclohexyl-3-oxo-4-pyridin-2-ylbutan-2-yl)pyrimidine-2,4-dione |
| SMILES | O=C(Cc1ccccn1)C(CC1CCCCC1)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C19H23N3O3/c23-17(13-15-8-4-5-10-20-15)16(12-14-6-2-1-3-7-14)22-11-9-18(24)21-19(22)25/h4-5,8-11,14,16H,1-3,6-7,12-13H2,(H,21,24,25) |
| InChIKey | DJBCKHLUUBBDJE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |