C20H25N3O2 — CID 58284079
3-[(2S)-1-cyclopentyl-4-(5-methyl-2-pyridinyl)-3-oxobutan-2-yl]-6-methylpyrimidin-4-one (PubChem CID 58284079) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[(2S)-1-cyclopentyl-4-(5-methyl-2-pyridinyl)-3-oxobutan-2-yl]-6-methylpyrimidin-4-one.
| Compound Name | 3-[(2S)-1-cyclopentyl-4-(5-methyl-2-pyridinyl)-3-oxobutan-2-yl]-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 58284079 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-[(2S)-1-cyclopentyl-4-(5-methyl-2-pyridinyl)-3-oxobutan-2-yl]-6-methylpyrimidin-4-one |
| SMILES | Cc1ccc(CC(=O)[C@H](CC2CCCC2)n2cnc(C)cc2=O)nc1 |
| InChI | InChI=1S/C20H25N3O2/c1-14-7-8-17(21-12-14)11-19(24)18(10-16-5-3-4-6-16)23-13-22-15(2)9-20(23)25/h7-9,12-13,16,18H,3-6,10-11H2,1-2H3/t18-/m0/s1 |
| InChIKey | OMYKOVCVCMELHS-SFHVURJKSA-N |
| XLogP | 3.19 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |