C31H37N3O6S — CID 59913836
(2R,3S)-N-[(2R)-1-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methyl-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-prop-2-enoxybutanediamide (PubChem CID 59913836) has the molecular formula C31H37N3O6S and a molecular weight of 579.72 g/mol. Its IUPAC name is (2R,3S)-N-[(2R)-1-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methyl-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-prop-2-enoxybutanediamide.
| Compound Name | (2R,3S)-N-[(2R)-1-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methyl-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-prop-2-enoxybutanediamide |
|---|---|
| PubChem CID | 59913836 |
| Molecular Formula | C31H37N3O6S |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | (2R,3S)-N-[(2R)-1-amino-3-[(4-methoxyphenyl)methylsulfanyl]-3-methyl-1-oxobutan-2-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-prop-2-enoxybutanediamide |
| SMILES | C=CCO[C@H](C(=O)NO)[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@H](C(N)=O)C(C)(C)SCc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H37N3O6S/c1-5-16-40-26(30(37)34-38)25(18-21-10-13-22-8-6-7-9-23(22)17-21)29(36)33-27(28(32)35)31(2,3)41-19-20-11-14-24(39-4)15-12-20/h5-15,17,25-27,38H,1,16,18-19H2,2-4H3,(H2,32,35)(H,33,36)(H,34,37)/t25-,26+,27-/m1/s1 |
| InChIKey | ZXJCQHCMDGFXKS-KWXIBIRDSA-N |
| XLogP | 3.77 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|