C27H34N2O6 — CID 10116809
N-[(3S)-4-tert-butyl-4-methyl-2-oxooxolan-3-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-prop-2-enoxybutanediamide (PubChem CID 10116809) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[(3S)-4-tert-butyl-4-methyl-2-oxooxolan-3-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-prop-2-enoxybutanediamide.
| Compound Name | N-[(3S)-4-tert-butyl-4-methyl-2-oxooxolan-3-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-prop-2-enoxybutanediamide |
|---|---|
| PubChem CID | 10116809 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | N-[(3S)-4-tert-butyl-4-methyl-2-oxooxolan-3-yl]-N'-hydroxy-2-(naphthalen-2-ylmethyl)-3-prop-2-enoxybutanediamide |
| SMILES | C=CCOC(C(=O)NO)C(Cc1ccc2ccccc2c1)C(=O)N[C@@H]1C(=O)OCC1(C)C(C)(C)C |
| InChI | InChI=1S/C27H34N2O6/c1-6-13-34-21(24(31)29-33)20(15-17-11-12-18-9-7-8-10-19(18)14-17)23(30)28-22-25(32)35-16-27(22,5)26(2,3)4/h6-12,14,20-22,33H,1,13,15-16H2,2-5H3,(H,28,30)(H,29,31)/t20?,21?,22-,27?/m1/s1 |
| InChIKey | HQSQDPYWUOLAPC-TYTXIAONSA-N |
| XLogP | 3.17 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|