About ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate
ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate (PubChem CID 54174226) has the molecular formula C27H36O6
and a molecular weight of 456.58 g/mol. Its IUPAC name is ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate.
Molecular Properties
| Compound Name | ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate |
| PubChem CID | 54174226 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate |
| SMILES | CC(C)(C)OC(=O)[C@H](O)[C@@H](OCC=CCCc1ccc2ccccc2c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H36O6/c1-26(2,3)32-24(29)22(28)23(25(30)33-27(4,5)6)31-17-11-7-8-12-19-15-16-20-13-9-10-14-21(20)18-19/h7,9-11,13-16,18,22-23,28H,8,12,17H2,1-6H3/t22-,23-/m1/s1 |
| InChIKey | OXCRQAKAUVRUFL-DHIUTWEWSA-N |
| XLogP | 4.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate?
The IUPAC name of ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate (CID 54174226) is ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate.
What is the SMILES notation for ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate?
The canonical SMILES for ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate is CC(C)(C)OC(=O)[C@H](O)[C@@H](OCC=CCCc1ccc2ccccc2c1)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate?
The InChIKey is OXCRQAKAUVRUFL-DHIUTWEWSA-N. The full InChI is InChI=1S/C27H36O6/c1-26(2,3)32-24(29)22(28)23(25(30)33-27(4,5)6)31-17-11-7-8-12-19-15-16-20-13-9-10-14-21(20)18-19/h7,9-11,13-16,18,22-23,28H,8,12,17H2,1-6H3/t22-,23-/m1/s1.
What are the key properties of ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate?
ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate has a molecular weight of 456.58 g/mol, XLogP of 4.76, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2R,3R)-2-hydroxy-3-(5-naphthalen-2-ylpent-2-enoxy)butanedioate is sourced from PubChem (CID 54174226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).