C34H42O8 — CID 54455531
4-O-benzyl 1-O-tert-butyl (2R,3R)-3-(2-ethoxy-2-oxoethoxy)-2-(5-naphthalen-2-ylpentoxy)butanedioate (PubChem CID 54455531) has the molecular formula C34H42O8 and a molecular weight of 578.70 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (2R,3R)-3-(2-ethoxy-2-oxoethoxy)-2-(5-naphthalen-2-ylpentoxy)butanedioate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl (2R,3R)-3-(2-ethoxy-2-oxoethoxy)-2-(5-naphthalen-2-ylpentoxy)butanedioate |
|---|---|
| PubChem CID | 54455531 |
| Molecular Formula | C34H42O8 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (2R,3R)-3-(2-ethoxy-2-oxoethoxy)-2-(5-naphthalen-2-ylpentoxy)butanedioate |
| SMILES | CCOC(=O)CO[C@@H](C(=O)OCc1ccccc1)[C@@H](OCCCCCc1ccc2ccccc2c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H42O8/c1-5-38-29(35)24-40-30(32(36)41-23-26-15-8-6-9-16-26)31(33(37)42-34(2,3)4)39-21-13-7-10-14-25-19-20-27-17-11-12-18-28(27)22-25/h6,8-9,11-12,15-20,22,30-31H,5,7,10,13-14,21,23-24H2,1-4H3/t30-,31-/m1/s1 |
| InChIKey | WXXYVNHPKFPZPD-FIRIVFDPSA-N |
| XLogP | 5.97 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|