C40H55NO9 — CID 67580551
(2R,3R)-4-[5-[4-(methoxymethoxy)-3,5-dimethylphenyl]pentylamino]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid (PubChem CID 67580551) has the molecular formula C40H55NO9 and a molecular weight of 693.88 g/mol. Its IUPAC name is (2R,3R)-4-[5-[4-(methoxymethoxy)-3,5-dimethylphenyl]pentylamino]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid.
| Compound Name | (2R,3R)-4-[5-[4-(methoxymethoxy)-3,5-dimethylphenyl]pentylamino]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67580551 |
| Molecular Formula | C40H55NO9 |
| Molecular Weight | 693.88 g/mol |
| Exact Mass | 693.39 |
| IUPAC Name | (2R,3R)-4-[5-[4-(methoxymethoxy)-3,5-dimethylphenyl]pentylamino]-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid |
| SMILES | COCOc1c(C)cc(CCCCCNC(=O)[C@H](OCCCCCc2ccc3ccccc3c2)[C@@H](OCC(=O)OC(C)(C)C)C(=O)O)cc1C |
| InChI | InChI=1S/C40H55NO9/c1-28-23-31(24-29(2)35(28)49-27-46-6)16-9-7-13-21-41-38(43)36(37(39(44)45)48-26-34(42)50-40(3,4)5)47-22-14-8-10-15-30-19-20-32-17-11-12-18-33(32)25-30/h11-12,17-20,23-25,36-37H,7-10,13-16,21-22,26-27H2,1-6H3,(H,41,43)(H,44,45)/t36-,37-/m1/s1 |
| InChIKey | FXPAFYUBBXNBJM-FZNHDDJXSA-N |
| XLogP | 6.88 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.88 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|