C34H42N2O7 — CID 67580594
2-(carboxymethoxy)-3-[4-(2,3-dihydro-1H-inden-5-ylamino)butoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid (PubChem CID 67580594) has the molecular formula C34H42N2O7 and a molecular weight of 590.72 g/mol. Its IUPAC name is 2-(carboxymethoxy)-3-[4-(2,3-dihydro-1H-inden-5-ylamino)butoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-3-[4-(2,3-dihydro-1H-inden-5-ylamino)butoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67580594 |
| Molecular Formula | C34H42N2O7 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 2-(carboxymethoxy)-3-[4-(2,3-dihydro-1H-inden-5-ylamino)butoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid |
| SMILES | O=C(O)COC(C(=O)O)C(OCCCCNc1ccc2c(c1)CCC2)C(=O)NCCCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H42N2O7/c37-30(38)23-43-32(34(40)41)31(42-20-7-6-18-35-29-17-16-26-12-8-13-28(26)22-29)33(39)36-19-5-1-2-9-24-14-15-25-10-3-4-11-27(25)21-24/h3-4,10-11,14-17,21-22,31-32,35H,1-2,5-9,12-13,18-20,23H2,(H,36,39)(H,37,38)(H,40,41) |
| InChIKey | NYDCATQTLNJYDH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|