C33H41ClN2O7 — CID 67580607
2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-(6-naphthalen-2-ylhexylamino)-4-oxobutanoic acid (PubChem CID 67580607) has the molecular formula C33H41ClN2O7 and a molecular weight of 613.15 g/mol. Its IUPAC name is 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-(6-naphthalen-2-ylhexylamino)-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-(6-naphthalen-2-ylhexylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67580607 |
| Molecular Formula | C33H41ClN2O7 |
| Molecular Weight | 613.15 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-(6-naphthalen-2-ylhexylamino)-4-oxobutanoic acid |
| SMILES | Cc1ccc(NCCCCOC(C(=O)NCCCCCCc2ccc3ccccc3c2)C(OCC(=O)O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C33H41ClN2O7/c1-23-13-16-27(21-28(23)34)35-17-8-9-19-42-30(31(33(40)41)43-22-29(37)38)32(39)36-18-7-3-2-4-10-24-14-15-25-11-5-6-12-26(25)20-24/h5-6,11-16,20-21,30-31,35H,2-4,7-10,17-19,22H2,1H3,(H,36,39)(H,37,38)(H,40,41) |
| InChIKey | TTZGJBYACKRJSD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.15 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|