C31H42ClNO7 — CID 67582387
2-(carboxymethoxy)-4-[5-(3-chloro-4-methylphenyl)pentylamino]-3-[5-(3,4-dimethylphenyl)pentoxy]-4-oxobutanoic acid (PubChem CID 67582387) has the molecular formula C31H42ClNO7 and a molecular weight of 576.13 g/mol. Its IUPAC name is 2-(carboxymethoxy)-4-[5-(3-chloro-4-methylphenyl)pentylamino]-3-[5-(3,4-dimethylphenyl)pentoxy]-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-4-[5-(3-chloro-4-methylphenyl)pentylamino]-3-[5-(3,4-dimethylphenyl)pentoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67582387 |
| Molecular Formula | C31H42ClNO7 |
| Molecular Weight | 576.13 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 2-(carboxymethoxy)-4-[5-(3-chloro-4-methylphenyl)pentylamino]-3-[5-(3,4-dimethylphenyl)pentoxy]-4-oxobutanoic acid |
| SMILES | Cc1ccc(CCCCCOC(C(=O)NCCCCCc2ccc(C)c(Cl)c2)C(OCC(=O)O)C(=O)O)cc1C |
| InChI | InChI=1S/C31H42ClNO7/c1-21-12-14-24(18-23(21)3)10-7-5-9-17-39-28(29(31(37)38)40-20-27(34)35)30(36)33-16-8-4-6-11-25-15-13-22(2)26(32)19-25/h12-15,18-19,28-29H,4-11,16-17,20H2,1-3H3,(H,33,36)(H,34,35)(H,37,38) |
| InChIKey | ZRUAVBGEZIIECT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.13 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|