C33H47NO7 — CID 67612210
2-(carboxymethoxy)-3-[5-(3,4-dimethylphenyl)pentoxy]-4-[7-(4-methylphenyl)heptylamino]-4-oxobutanoic acid (PubChem CID 67612210) has the molecular formula C33H47NO7 and a molecular weight of 569.74 g/mol. Its IUPAC name is 2-(carboxymethoxy)-3-[5-(3,4-dimethylphenyl)pentoxy]-4-[7-(4-methylphenyl)heptylamino]-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-3-[5-(3,4-dimethylphenyl)pentoxy]-4-[7-(4-methylphenyl)heptylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67612210 |
| Molecular Formula | C33H47NO7 |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.34 |
| IUPAC Name | 2-(carboxymethoxy)-3-[5-(3,4-dimethylphenyl)pentoxy]-4-[7-(4-methylphenyl)heptylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(CCCCCCCNC(=O)C(OCCCCCc2ccc(C)c(C)c2)C(OCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C33H47NO7/c1-24-14-17-27(18-15-24)12-8-5-4-6-10-20-34-32(37)30(31(33(38)39)41-23-29(35)36)40-21-11-7-9-13-28-19-16-25(2)26(3)22-28/h14-19,22,30-31H,4-13,20-21,23H2,1-3H3,(H,34,37)(H,35,36)(H,38,39) |
| InChIKey | JPPWPYLVEHABRZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|