C34H39N3O7 — CID 67580841
2-(carboxymethoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxo-3-(5-quinoxalin-6-ylpentoxy)butanoic acid (PubChem CID 67580841) has the molecular formula C34H39N3O7 and a molecular weight of 601.70 g/mol. Its IUPAC name is 2-(carboxymethoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxo-3-(5-quinoxalin-6-ylpentoxy)butanoic acid.
| Compound Name | 2-(carboxymethoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxo-3-(5-quinoxalin-6-ylpentoxy)butanoic acid |
|---|---|
| PubChem CID | 67580841 |
| Molecular Formula | C34H39N3O7 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 2-(carboxymethoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxo-3-(5-quinoxalin-6-ylpentoxy)butanoic acid |
| SMILES | O=C(O)COC(C(=O)O)C(OCCCCCc1ccc2nccnc2c1)C(=O)NCCCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H39N3O7/c38-30(39)23-44-32(34(41)42)31(43-20-8-2-4-10-25-14-16-28-29(22-25)36-19-18-35-28)33(40)37-17-7-1-3-9-24-13-15-26-11-5-6-12-27(26)21-24/h5-6,11-16,18-19,21-22,31-32H,1-4,7-10,17,20,23H2,(H,37,40)(H,38,39)(H,41,42) |
| InChIKey | AEIWDUQBWJLSII-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|