C39H51NO9 — CID 67581627
2-(carboxymethoxy)-4-[5-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)pentylamino]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid (PubChem CID 67581627) has the molecular formula C39H51NO9 and a molecular weight of 677.84 g/mol. Its IUPAC name is 2-(carboxymethoxy)-4-[5-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)pentylamino]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-4-[5-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)pentylamino]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67581627 |
| Molecular Formula | C39H51NO9 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.36 |
| IUPAC Name | 2-(carboxymethoxy)-4-[5-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)pentylamino]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCCCNC(=O)C(OCCCCCc1ccc3ccccc3c1)C(OCC(=O)O)C(=O)O)O2 |
| InChI | InChI=1S/C39H51NO9/c1-25-26(2)34-31(27(3)33(25)43)18-20-39(4,49-34)19-10-6-11-21-40-37(44)35(36(38(45)46)48-24-32(41)42)47-22-12-5-7-13-28-16-17-29-14-8-9-15-30(29)23-28/h8-9,14-17,23,35-36,43H,5-7,10-13,18-22,24H2,1-4H3,(H,40,44)(H,41,42)(H,45,46) |
| InChIKey | VIGDJVLNYNVQHK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|