C35H43NO9 — CID 67581995
3-[5-(1,3-benzodioxol-5-yl)pentoxy]-2-(2-ethoxy-2-oxoethoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid (PubChem CID 67581995) has the molecular formula C35H43NO9 and a molecular weight of 621.73 g/mol. Its IUPAC name is 3-[5-(1,3-benzodioxol-5-yl)pentoxy]-2-(2-ethoxy-2-oxoethoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid.
| Compound Name | 3-[5-(1,3-benzodioxol-5-yl)pentoxy]-2-(2-ethoxy-2-oxoethoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67581995 |
| Molecular Formula | C35H43NO9 |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | 3-[5-(1,3-benzodioxol-5-yl)pentoxy]-2-(2-ethoxy-2-oxoethoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid |
| SMILES | CCOC(=O)COC(C(=O)O)C(OCCCCCc1ccc2c(c1)OCO2)C(=O)NCCCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H43NO9/c1-2-41-31(37)23-43-33(35(39)40)32(42-20-10-4-6-12-26-16-18-29-30(22-26)45-24-44-29)34(38)36-19-9-3-5-11-25-15-17-27-13-7-8-14-28(27)21-25/h7-8,13-18,21-22,32-33H,2-6,9-12,19-20,23-24H2,1H3,(H,36,38)(H,39,40) |
| InChIKey | MFAXWSJHKRTQJV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|