C35H45NO7 — CID 67580531
(2R,3R)-2-(carboxymethoxy)-3-[5-(3,4-dimethylphenyl)pentoxy]-4-[methyl(5-naphthalen-2-ylpentyl)amino]-4-oxobutanoic acid (PubChem CID 67580531) has the molecular formula C35H45NO7 and a molecular weight of 591.75 g/mol. Its IUPAC name is (2R,3R)-2-(carboxymethoxy)-3-[5-(3,4-dimethylphenyl)pentoxy]-4-[methyl(5-naphthalen-2-ylpentyl)amino]-4-oxobutanoic acid.
| Compound Name | (2R,3R)-2-(carboxymethoxy)-3-[5-(3,4-dimethylphenyl)pentoxy]-4-[methyl(5-naphthalen-2-ylpentyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67580531 |
| Molecular Formula | C35H45NO7 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | (2R,3R)-2-(carboxymethoxy)-3-[5-(3,4-dimethylphenyl)pentoxy]-4-[methyl(5-naphthalen-2-ylpentyl)amino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(CCCCCO[C@@H](C(=O)N(C)CCCCCc2ccc3ccccc3c2)[C@@H](OCC(=O)O)C(=O)O)cc1C |
| InChI | InChI=1S/C35H45NO7/c1-25-16-17-27(22-26(25)2)12-7-5-11-21-42-32(33(35(40)41)43-24-31(37)38)34(39)36(3)20-10-4-6-13-28-18-19-29-14-8-9-15-30(29)23-28/h8-9,14-19,22-23,32-33H,4-7,10-13,20-21,24H2,1-3H3,(H,37,38)(H,40,41)/t32-,33-/m1/s1 |
| InChIKey | NLGMFYBNRSGGFH-CZNDPXEESA-N |
| XLogP | 5.98 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|