C30H37NO8 — CID 67580698
2-(carboxymethoxy)-3-[5-(furan-3-yl)pentoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid (PubChem CID 67580698) has the molecular formula C30H37NO8 and a molecular weight of 539.63 g/mol. Its IUPAC name is 2-(carboxymethoxy)-3-[5-(furan-3-yl)pentoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-3-[5-(furan-3-yl)pentoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67580698 |
| Molecular Formula | C30H37NO8 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-(carboxymethoxy)-3-[5-(furan-3-yl)pentoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid |
| SMILES | O=C(O)COC(C(=O)O)C(OCCCCCc1ccoc1)C(=O)NCCCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H37NO8/c32-26(33)21-39-28(30(35)36)27(38-17-8-2-4-10-23-15-18-37-20-23)29(34)31-16-7-1-3-9-22-13-14-24-11-5-6-12-25(24)19-22/h5-6,11-15,18-20,27-28H,1-4,7-10,16-17,21H2,(H,31,34)(H,32,33)(H,35,36) |
| InChIKey | QOLJDMZOFARCQP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|