C36H41NO7 — CID 67580830
3-(4-naphthalen-2-yloxybutoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxo-2-(2-oxopropoxy)butanoic acid (PubChem CID 67580830) has the molecular formula C36H41NO7 and a molecular weight of 599.72 g/mol. Its IUPAC name is 3-(4-naphthalen-2-yloxybutoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxo-2-(2-oxopropoxy)butanoic acid.
| Compound Name | 3-(4-naphthalen-2-yloxybutoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxo-2-(2-oxopropoxy)butanoic acid |
|---|---|
| PubChem CID | 67580830 |
| Molecular Formula | C36H41NO7 |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | 3-(4-naphthalen-2-yloxybutoxy)-4-(5-naphthalen-2-ylpentylamino)-4-oxo-2-(2-oxopropoxy)butanoic acid |
| SMILES | CC(=O)COC(C(=O)O)C(OCCCCOc1ccc2ccccc2c1)C(=O)NCCCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H41NO7/c1-26(38)25-44-34(36(40)41)33(43-22-10-9-21-42-32-19-18-29-13-5-7-15-31(29)24-32)35(39)37-20-8-2-3-11-27-16-17-28-12-4-6-14-30(28)23-27/h4-7,12-19,23-24,33-34H,2-3,8-11,20-22,25H2,1H3,(H,37,39)(H,40,41) |
| InChIKey | RZZUIUCCGTVIMB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|