C33H42N2O7 — CID 67581358
2-(carboxymethoxy)-3-[4-(3,5-dimethylanilino)butoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid (PubChem CID 67581358) has the molecular formula C33H42N2O7 and a molecular weight of 578.71 g/mol. Its IUPAC name is 2-(carboxymethoxy)-3-[4-(3,5-dimethylanilino)butoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-3-[4-(3,5-dimethylanilino)butoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67581358 |
| Molecular Formula | C33H42N2O7 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | 2-(carboxymethoxy)-3-[4-(3,5-dimethylanilino)butoxy]-4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoic acid |
| SMILES | Cc1cc(C)cc(NCCCCOC(C(=O)NCCCCCc2ccc3ccccc3c2)C(OCC(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C33H42N2O7/c1-23-18-24(2)20-28(19-23)34-15-8-9-17-41-30(31(33(39)40)42-22-29(36)37)32(38)35-16-7-3-4-10-25-13-14-26-11-5-6-12-27(26)21-25/h5-6,11-14,18-21,30-31,34H,3-4,7-10,15-17,22H2,1-2H3,(H,35,38)(H,36,37)(H,39,40) |
| InChIKey | CYOIFIZRLKKDDC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|