C32H45ClN2O7 — CID 67582020
2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-[7-(3,4-dimethylphenyl)heptylamino]-4-oxobutanoic acid (PubChem CID 67582020) has the molecular formula C32H45ClN2O7 and a molecular weight of 605.17 g/mol. Its IUPAC name is 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-[7-(3,4-dimethylphenyl)heptylamino]-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-[7-(3,4-dimethylphenyl)heptylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67582020 |
| Molecular Formula | C32H45ClN2O7 |
| Molecular Weight | 605.17 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-[7-(3,4-dimethylphenyl)heptylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(CCCCCCCNC(=O)C(OCCCCNc2ccc(C)c(Cl)c2)C(OCC(=O)O)C(=O)O)cc1C |
| InChI | InChI=1S/C32H45ClN2O7/c1-22-12-14-25(19-24(22)3)11-7-5-4-6-8-17-35-31(38)29(30(32(39)40)42-21-28(36)37)41-18-10-9-16-34-26-15-13-23(2)27(33)20-26/h12-15,19-20,29-30,34H,4-11,16-18,21H2,1-3H3,(H,35,38)(H,36,37)(H,39,40) |
| InChIKey | LSZPKLFBAFWZEN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.17 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|