C35H40N2O7 — CID 67582014
2-(carboxymethoxy)-4-[4-(naphthalen-2-ylamino)butylamino]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid (PubChem CID 67582014) has the molecular formula C35H40N2O7 and a molecular weight of 600.71 g/mol. Its IUPAC name is 2-(carboxymethoxy)-4-[4-(naphthalen-2-ylamino)butylamino]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-4-[4-(naphthalen-2-ylamino)butylamino]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67582014 |
| Molecular Formula | C35H40N2O7 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 2-(carboxymethoxy)-4-[4-(naphthalen-2-ylamino)butylamino]-3-(5-naphthalen-2-ylpentoxy)-4-oxobutanoic acid |
| SMILES | O=C(O)COC(C(=O)O)C(OCCCCCc1ccc2ccccc2c1)C(=O)NCCCCNc1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H40N2O7/c38-31(39)24-44-33(35(41)42)32(43-21-9-1-2-10-25-15-16-26-11-3-5-13-28(26)22-25)34(40)37-20-8-7-19-36-30-18-17-27-12-4-6-14-29(27)23-30/h3-6,11-18,22-23,32-33,36H,1-2,7-10,19-21,24H2,(H,37,40)(H,38,39)(H,41,42) |
| InChIKey | HHPSAPUUSGHCOU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|