C29H38Cl2N2O7 — CID 67581486
2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-[6-(4-chlorophenyl)hexylamino]-4-oxobutanoic acid (PubChem CID 67581486) has the molecular formula C29H38Cl2N2O7 and a molecular weight of 597.54 g/mol. Its IUPAC name is 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-[6-(4-chlorophenyl)hexylamino]-4-oxobutanoic acid.
| Compound Name | 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-[6-(4-chlorophenyl)hexylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67581486 |
| Molecular Formula | C29H38Cl2N2O7 |
| Molecular Weight | 597.54 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 2-(carboxymethoxy)-3-[4-(3-chloro-4-methylanilino)butoxy]-4-[6-(4-chlorophenyl)hexylamino]-4-oxobutanoic acid |
| SMILES | Cc1ccc(NCCCCOC(C(=O)NCCCCCCc2ccc(Cl)cc2)C(OCC(=O)O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C29H38Cl2N2O7/c1-20-9-14-23(18-24(20)31)32-15-6-7-17-39-26(27(29(37)38)40-19-25(34)35)28(36)33-16-5-3-2-4-8-21-10-12-22(30)13-11-21/h9-14,18,26-27,32H,2-8,15-17,19H2,1H3,(H,33,36)(H,34,35)(H,37,38) |
| InChIKey | LAHKOUBGKHYGFV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|