C36H41NO5 — CID 67580421
(2R)-2-(5-naphthalen-2-ylpentoxy)-N-(5-naphthalen-2-ylpentyl)-2-[(2R)-3-oxo-1,4-dioxan-2-yl]acetamide (PubChem CID 67580421) has the molecular formula C36H41NO5 and a molecular weight of 567.73 g/mol. Its IUPAC name is (2R)-2-(5-naphthalen-2-ylpentoxy)-N-(5-naphthalen-2-ylpentyl)-2-[(2R)-3-oxo-1,4-dioxan-2-yl]acetamide.
| Compound Name | (2R)-2-(5-naphthalen-2-ylpentoxy)-N-(5-naphthalen-2-ylpentyl)-2-[(2R)-3-oxo-1,4-dioxan-2-yl]acetamide |
|---|---|
| PubChem CID | 67580421 |
| Molecular Formula | C36H41NO5 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | (2R)-2-(5-naphthalen-2-ylpentoxy)-N-(5-naphthalen-2-ylpentyl)-2-[(2R)-3-oxo-1,4-dioxan-2-yl]acetamide |
| SMILES | O=C(NCCCCCc1ccc2ccccc2c1)[C@H](OCCCCCc1ccc2ccccc2c1)[C@H]1OCCOC1=O |
| InChI | InChI=1S/C36H41NO5/c38-35(37-21-9-1-3-11-27-17-19-29-13-5-7-15-31(29)25-27)33(34-36(39)42-24-23-41-34)40-22-10-2-4-12-28-18-20-30-14-6-8-16-32(30)26-28/h5-8,13-20,25-26,33-34H,1-4,9-12,21-24H2,(H,37,38)/t33-,34-/m1/s1 |
| InChIKey | NIRCWZGUHHNLIS-KKLWWLSJSA-N |
| XLogP | 6.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|