C25H36O6 — CID 57233375
(2R,3S)-4-hydroxy-3-(methoxymethoxy)-5,5-dimethyl-2-(5-naphthalen-2-ylpentoxy)hexanoic acid (PubChem CID 57233375) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (2R,3S)-4-hydroxy-3-(methoxymethoxy)-5,5-dimethyl-2-(5-naphthalen-2-ylpentoxy)hexanoic acid.
| Compound Name | (2R,3S)-4-hydroxy-3-(methoxymethoxy)-5,5-dimethyl-2-(5-naphthalen-2-ylpentoxy)hexanoic acid |
|---|---|
| PubChem CID | 57233375 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (2R,3S)-4-hydroxy-3-(methoxymethoxy)-5,5-dimethyl-2-(5-naphthalen-2-ylpentoxy)hexanoic acid |
| SMILES | COCO[C@@H](C(O)C(C)(C)C)[C@@H](OCCCCCc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C25H36O6/c1-25(2,3)23(26)21(31-17-29-4)22(24(27)28)30-15-9-5-6-10-18-13-14-19-11-7-8-12-20(19)16-18/h7-8,11-14,16,21-23,26H,5-6,9-10,15,17H2,1-4H3,(H,27,28)/t21-,22-,23?/m1/s1 |
| InChIKey | GXEWWZPUEAXABG-WELAQSEPSA-N |
| XLogP | 4.42 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|