C22H30N2O4 — CID 142686008
4-O-tert-butyl 1-O-methyl 2-amino-2-(3-naphthalen-2-ylpropylamino)butanedioate (PubChem CID 142686008) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-amino-2-(3-naphthalen-2-ylpropylamino)butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-amino-2-(3-naphthalen-2-ylpropylamino)butanedioate |
|---|---|
| PubChem CID | 142686008 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-amino-2-(3-naphthalen-2-ylpropylamino)butanedioate |
| SMILES | COC(=O)C(N)(CC(=O)OC(C)(C)C)NCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H30N2O4/c1-21(2,3)28-19(25)15-22(23,20(26)27-4)24-13-7-8-16-11-12-17-9-5-6-10-18(17)14-16/h5-6,9-12,14,24H,7-8,13,15,23H2,1-4H3 |
| InChIKey | YHUYNFXQDOEKBJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|