C23H31NO3 — CID 141000789
tert-butyl 4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoate (PubChem CID 141000789) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl 4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoate.
| Compound Name | tert-butyl 4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 141000789 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | tert-butyl 4-(5-naphthalen-2-ylpentylamino)-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)NCCCCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H31NO3/c1-23(2,3)27-22(26)15-14-21(25)24-16-8-4-5-9-18-12-13-19-10-6-7-11-20(19)17-18/h6-7,10-13,17H,4-5,8-9,14-16H2,1-3H3,(H,24,25) |
| InChIKey | VJTFOJWIUIMLQG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|