C26H37N3O4 — CID 139381177
tert-butyl (4R)-4-amino-5-[[(2S)-1-(butylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-oxopentanoate (PubChem CID 139381177) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is tert-butyl (4R)-4-amino-5-[[(2S)-1-(butylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-oxopentanoate.
| Compound Name | tert-butyl (4R)-4-amino-5-[[(2S)-1-(butylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 139381177 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | tert-butyl (4R)-4-amino-5-[[(2S)-1-(butylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| SMILES | CCCCNC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)[C@H](N)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H37N3O4/c1-5-6-15-28-25(32)22(17-18-11-12-19-9-7-8-10-20(19)16-18)29-24(31)21(27)13-14-23(30)33-26(2,3)4/h7-12,16,21-22H,5-6,13-15,17,27H2,1-4H3,(H,28,32)(H,29,31)/t21-,22+/m1/s1 |
| InChIKey | LQWKXOWXFSWUHH-YADHBBJMSA-N |
| XLogP | 3.23 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|