C24H37N3O6 — CID 59913846
(2S,3R)-3-(2,3-dihydro-1H-inden-2-ylmethyl)-N-hydroxy-N'-[(2S)-1-(methoxyamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-propoxybutanediamide (PubChem CID 59913846) has the molecular formula C24H37N3O6 and a molecular weight of 463.58 g/mol. Its IUPAC name is (2S,3R)-3-(2,3-dihydro-1H-inden-2-ylmethyl)-N-hydroxy-N'-[(2S)-1-(methoxyamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-propoxybutanediamide.
| Compound Name | (2S,3R)-3-(2,3-dihydro-1H-inden-2-ylmethyl)-N-hydroxy-N'-[(2S)-1-(methoxyamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-propoxybutanediamide |
|---|---|
| PubChem CID | 59913846 |
| Molecular Formula | C24H37N3O6 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | (2S,3R)-3-(2,3-dihydro-1H-inden-2-ylmethyl)-N-hydroxy-N'-[(2S)-1-(methoxyamino)-3,3-dimethyl-1-oxobutan-2-yl]-2-propoxybutanediamide |
| SMILES | CCCO[C@H](C(=O)NO)[C@@H](CC1Cc2ccccc2C1)C(=O)N[C@H](C(=O)NOC)C(C)(C)C |
| InChI | InChI=1S/C24H37N3O6/c1-6-11-33-19(22(29)26-31)18(14-15-12-16-9-7-8-10-17(16)13-15)21(28)25-20(24(2,3)4)23(30)27-32-5/h7-10,15,18-20,31H,6,11-14H2,1-5H3,(H,25,28)(H,26,29)(H,27,30)/t18-,19+,20-/m1/s1 |
| InChIKey | JNJDURDNHSIWFN-HSALFYBXSA-N |
| XLogP | 1.92 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|